CymitQuimica logo

CAS 886363-26-4

:

2-[4-(3,5-difluorophenyl)phenyl]acetic acid

Description:
2-[4-(3,5-Difluorophenyl)phenyl]acetic acid, identified by its CAS number 886363-26-4, is an organic compound characterized by its unique molecular structure, which includes a phenyl ring substituted with a difluorophenyl group and an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, this compound represents a class of molecules that could have significant implications in medicinal chemistry and drug development.
Formula:C14H10F2O2
InChI:InChI=1/C14H10F2O2/c15-12-6-11(7-13(16)8-12)10-3-1-9(2-4-10)5-14(17)18/h1-4,6-8H,5H2,(H,17,18)
InChI key:INSAZACHUCPLOA-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)O)c1cc(cc(c1)F)F
Synonyms:
  • (3',5'-Difluorobiphenyl-4-yl)acetic acid
  • [1,1'-Biphenyl]-4-acetic acid, 3',5'-difluoro-
Found 2 products.