CymitQuimica logo

CAS 886363-36-6

:

2-[4-(3,4-difluorophenyl)phenyl]acetic acid

Description:
2-[4-(3,4-Difluorophenyl)phenyl]acetic acid, identified by its CAS number 886363-36-6, is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with a difluorophenyl group and an acetic acid moiety. This compound typically exhibits properties associated with aromatic acids, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of fluorine atoms in the difluorophenyl group can influence its electronic properties, potentially enhancing lipophilicity and altering reactivity compared to non-fluorinated analogs. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. As with many organic compounds, handling should be conducted with care, considering safety data and potential environmental impacts.
Formula:C14H10F2O2
InChI:InChI=1/C14H10F2O2/c15-12-6-5-11(8-13(12)16)10-3-1-9(2-4-10)7-14(17)18/h1-6,8H,7H2,(H,17,18)
InChI key:UGFFUDBVWPNLEA-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)O)c1ccc(c(c1)F)F
Synonyms:
  • (3',4'-Difluorobiphenyl-4-yl)acetic acid
  • [1,1'-Biphenyl]-4-acetic acid, 3',4'-difluoro-
Found 2 products.