CymitQuimica logo

CAS 886363-46-8

:

3-(N-tert-butoxycarbonylcarbamimidoyl)benzoic acid

Description:
3-(N-tert-butoxycarbonylcarbamimidoyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a carbamimidoyl group that is protected by a tert-butoxycarbonyl (Boc) group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid and the carbamimidoyl group. The Boc group serves as a protective group, making the compound useful in synthetic organic chemistry, particularly in peptide synthesis and other applications where selective functionalization is required. The presence of the aromatic ring contributes to its stability and potential interactions in various chemical environments. Additionally, the compound may exhibit solubility in organic solvents, depending on the specific conditions, and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules in pharmaceutical and medicinal chemistry.
Formula:C13H16N2O4
InChI:InChI=1/C13H16N2O4/c1-13(2,3)19-12(18)15-10(14)8-5-4-6-9(7-8)11(16)17/h4-7H,1-3H3,(H,16,17)(H2,14,15,18)
SMILES:CC(C)(C)OC(=NC(=N)c1cccc(c1)C(=O)O)O
Synonyms:
  • 3-[N-(tert-Butoxycarbonyl)carbamimidoyl]benzoic acid
Found 2 products.