CAS 886363-59-3

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid

Description:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid, with the CAS number 886363-59-3, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, an amino group, and an α-phenyl substituent. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. It is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's functional groups may influence its reactivity, polarity, and overall pharmacokinetic properties. As with many synthetic compounds, its safety and handling require adherence to appropriate guidelines, and its biological activity would need to be evaluated through experimental studies to determine its efficacy and potential therapeutic applications.

Formula: C₁₈H₂₆N₂O₄

InChI: InChI=1S/C18H26N2O4/c1-18(2,3)24-17(23)19-14-9-11-20(12-10-14)15(16(21)22)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,19,23)(H,21,22)

InChI key: InChIKey=UPZMQRZINKLLKM-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N1CCC(NC(OC(C)(C)C)=O)CC1)C2=CC=CC=C2

Synonyms:

• 1-Piperidineacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-
• 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid

(4-N-BOC-AMINO-PIPERIDIN-1-YL)-PHENYL-ACETIC ACID

CAS: 886363-59-3

Formula: C₁₈H₂₆N₂O₄

Molecular weight: 334.4100

Ref: IN-DA00GSN4

(4-N-Boc-Amino-piperidin-1-yl)-phenyl-acetic acid

CAS: 886363-59-3

Formula: C₁₈H₂₆N₂O₄

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 334.416

Ref: 10-F041288