CymitQuimica logo

CAS 886363-59-3

:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid

Description:
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid, with the CAS number 886363-59-3, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, an amino group, and an α-phenyl substituent. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. It is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's functional groups may influence its reactivity, polarity, and overall pharmacokinetic properties. As with many synthetic compounds, its safety and handling require adherence to appropriate guidelines, and its biological activity would need to be evaluated through experimental studies to determine its efficacy and potential therapeutic applications.
Formula:C18H26N2O4
InChI:InChI=1S/C18H26N2O4/c1-18(2,3)24-17(23)19-14-9-11-20(12-10-14)15(16(21)22)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,19,23)(H,21,22)
InChI key:InChIKey=UPZMQRZINKLLKM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCC(NC(OC(C)(C)C)=O)CC1)C2=CC=CC=C2
Synonyms:
  • 1-Piperidineacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-
  • 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetic acid
Found 2 products.