CymitQuimica logo

CAS 886363-80-0

:

tert-butyl 8-amino-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate

Description:
Tert-butyl 8-amino-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate is a chemical compound that belongs to the benzodiazepine class, which is known for its psychoactive properties. This compound features a tetrahydro-benzodiazepine core, characterized by a fused bicyclic structure containing both a benzene and a diazepine ring. The presence of an amino group at the 8-position and a tert-butyl ester at the carboxylate position contributes to its unique chemical properties and potential biological activity. The tert-butyl group enhances lipophilicity, which may influence the compound's pharmacokinetics and ability to cross biological membranes. Additionally, the carboxylate moiety can participate in various chemical reactions, making it a versatile building block in medicinal chemistry. The compound's specific interactions with biological targets, such as receptors or enzymes, would require further investigation to elucidate its potential therapeutic applications. Overall, this compound exemplifies the structural diversity and complexity found within the benzodiazepine family.
Formula:C14H21N3O2
InChI:InChI=1/C14H21N3O2/c1-14(2,3)19-13(18)17-7-6-16-12-8-11(15)5-4-10(12)9-17/h4-5,8,16H,6-7,9,15H2,1-3H3
InChI key:ZULASIGKOAEFKW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCNc2cc(ccc2C1)N
Found 4 products.