CymitQuimica logo

CAS 886364-23-4

:

tert-butyl 9-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate

Description:
Tert-butyl 9-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate is a chemical compound that belongs to the benzodiazepine class, which is known for its psychoactive properties. This substance features a tetrahydro-benzodiazepine core, characterized by a fused bicyclic structure that includes a benzene ring and a diazepine ring. The tert-butyl group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties, such as absorption and distribution in biological systems. The presence of the methyl group at the 9-position may affect the compound's binding affinity to various receptors, which is crucial for its biological activity. Additionally, the carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and amidation. Overall, this compound's structural features indicate potential applications in medicinal chemistry, particularly in the development of anxiolytic or sedative agents, although specific biological activities would require further investigation through experimental studies.
Formula:C15H22N2O2
InChI:InChI=1/C15H22N2O2/c1-11-6-5-7-12-10-17(9-8-16-13(11)12)14(18)19-15(2,3)4/h5-7,16H,8-10H2,1-4H3
InChI key:KRENOWDAKOGMIJ-UHFFFAOYSA-N
SMILES:Cc1cccc2CN(CCNc12)C(=O)OC(C)(C)C
Found 3 products.