CAS 886364-30-3
:tert-butyl 7-bromo-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate
Description:
Tert-butyl 7-bromo-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a benzodiazepine core. This compound features a tert-butyl ester group, enhancing its lipophilicity and potentially influencing its pharmacological properties. The presence of a bromine atom at the 7-position of the benzodiazepine ring may impart unique reactivity and biological activity, making it of interest in medicinal chemistry. The tetrahydro configuration indicates that the compound has a saturated ring system, which can affect its conformational flexibility and interactions with biological targets. Additionally, the carboxylate functional group suggests potential for forming salts or participating in various chemical reactions. Overall, this compound may exhibit properties relevant to drug development, particularly in the context of central nervous system activity, due to the known effects of benzodiazepines. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C14H19BrN2O2
InChI:InChI=1/C14H19BrN2O2/c1-14(2,3)19-13(18)17-7-6-16-12-5-4-11(15)8-10(12)9-17/h4-5,8,16H,6-7,9H2,1-3H3
InChI key:XTVVPYZXTUZWFG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCNc2ccc(cc2C1)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-BOC-7-BROMO-2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPINE
CAS:Formula:C14H19BrN2O2Molecular weight:327.2169
