CymitQuimica logo

CAS 886364-33-6

:

tert-butyl 7-chloro-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate

Description:
Tert-butyl 7-chloro-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate is a chemical compound characterized by its complex structure, which includes a benzodiazepine core. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential bioactivity. The presence of a chlorine atom at the 7-position of the benzodiazepine ring may influence its pharmacological properties, potentially enhancing its interaction with biological targets. The tetrahydro structure indicates that the compound is a saturated derivative, which can affect its stability and reactivity. Typically, compounds of this class are studied for their potential therapeutic applications, including anxiolytic and sedative effects. The carboxylate functional group suggests that it may participate in various chemical reactions, such as esterification or amidation. Overall, the unique combination of functional groups and structural features makes this compound of interest in medicinal chemistry and drug development.
Formula:C14H19ClN2O2
InChI:InChI=1/C14H19ClN2O2/c1-14(2,3)19-13(18)17-7-6-16-12-5-4-11(15)8-10(12)9-17/h4-5,8,16H,6-7,9H2,1-3H3
InChI key:SVDLJDXSVLNEGB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCNc2ccc(cc2C1)Cl
Found 4 products.