CymitQuimica logo

CAS 886364-57-4

:

1-(6-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone

Description:
1-(6-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone, identified by its CAS number 886364-57-4, is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a trifluoroethanone functional group. This compound typically exhibits properties associated with both halogenated and aromatic compounds, such as increased reactivity due to the presence of the bromine atom and the electron-withdrawing trifluoroethanone group. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given the presence of the pyridine moiety, which is often found in biologically active compounds. The trifluoromethyl group can enhance lipophilicity and metabolic stability, making it an interesting candidate for further research. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis in various chemical contexts. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C7H3BrF3NO
InChI:InChI=1S/C7H3BrF3NO/c8-5-3-1-2-4(12-5)6(13)7(9,10)11/h1-3H
InChI key:InChIKey=IRHXXHPAPZNQEM-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1N=C(Br)C=CC1
Synonyms:
  • 2-Bromo-6-(2,2,2-trifluoroacetyl)pyridine
  • Ethanone, 1-(6-bromo-2-pyridinyl)-2,2,2-trifluoro-
  • 1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-one
  • 1-(6-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone
Found 2 products.