CymitQuimica logo

CAS 886364-79-0

:

2-[(3-bromophenyl)methyl]-3-(tert-butoxycarbonyl-methyl-amino)propanoic acid

Description:
2-[(3-bromophenyl)methyl]-3-(tert-butoxycarbonyl-methyl-amino)propanoic acid is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group, a tert-butoxycarbonyl (Boc) protecting group, and an amino acid backbone. The presence of the bromine atom in the phenyl ring contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The tert-butoxycarbonyl group serves as a protective moiety for the amino group, facilitating various chemical reactions without affecting the amino functionality. This compound is likely to exhibit both hydrophilic and lipophilic properties due to its diverse functional groups, influencing its solubility and interaction with biological systems. Additionally, the propanoic acid moiety suggests potential for forming salts or esters, which can further modify its pharmacokinetic properties. Overall, this compound's unique structural features make it a candidate for research in drug design and synthesis, particularly in targeting specific biological pathways or receptors.
Formula:C16H22BrNO4
InChI:InChI=1/C16H22BrNO4/c1-16(2,3)22-15(21)18(4)10-12(14(19)20)8-11-6-5-7-13(17)9-11/h5-7,9,12H,8,10H2,1-4H3,(H,19,20)
InChI key:MSPPAKCVWBPMPP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(C)CC(Cc1cccc(c1)Br)C(=O)O
Found 2 products.