CymitQuimica logo

CAS 886364-87-0

:

3-Bromo-α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]benzenepropanoic acid

Description:
3-Bromo-α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]benzenepropanoic acid, with the CAS number 886364-87-0, is a chemical compound characterized by its complex structure, which includes a bromine atom, an amino group, and a propanoic acid moiety. This compound features a benzene ring substituted with a bromo group and an amino acid derivative, indicating potential applications in medicinal chemistry or as a building block in organic synthesis. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may be used for protecting amino groups during chemical reactions. The compound's solubility, stability, and reactivity would depend on its functional groups and the overall molecular structure. As with many organic compounds, it is essential to handle it with care, considering safety data sheets for toxicity, flammability, and environmental impact. Its specific applications would likely be explored in pharmaceutical research or materials science, where such derivatives can play a role in drug development or synthesis of complex organic molecules.
Formula:C15H20BrNO4
InChI:InChI=1S/C15H20BrNO4/c1-15(2,3)21-14(20)17-9-11(13(18)19)7-10-5-4-6-12(16)8-10/h4-6,8,11H,7,9H2,1-3H3,(H,17,20)(H,18,19)
InChI key:InChIKey=PALAEQFKVALUOR-UHFFFAOYSA-N
SMILES:C(C(CNC(OC(C)(C)C)=O)C(O)=O)C1=CC(Br)=CC=C1
Synonyms:
  • Benzenepropanoic acid, 3-bromo-α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-
  • 3-Bromo-α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]benzenepropanoic acid
Found 2 products.