CymitQuimica logo

CAS 886364-92-7

:

5-CHLORO-4-METHYL-PYRIDIN-2-OL

Description:
5-Chloro-4-methyl-pyridin-2-ol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a hydroxyl group (-OH) at the 2-position and a chlorine atom at the 5-position, along with a methyl group (-CH3) at the 4-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The chlorine substituent can enhance the compound's reactivity, making it useful in various chemical reactions. Additionally, the presence of the hydroxyl group may impart some degree of acidity, influencing its behavior in different chemical environments. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H6ClNO
InChI:InChI=1S/C6H6ClNO/c1-4-2-6(9)8-3-5(4)7/h2-3H,1H3,(H,8,9)
InChI key:BSUJQJXODPSJTC-UHFFFAOYSA-N
SMILES:CC1=CC(=O)NC=C1Cl
Found 4 products.