CymitQuimica logo

CAS 886364-95-0

:

tert-butyl 3-(4-pyridylmethylamino)pyrrolidine-1-carboxylate

Description:
Tert-butyl 3-(4-pyridylmethylamino)pyrrolidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a tert-butyl ester group, and a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents like ethanol and dimethyl sulfoxide (DMSO). The presence of the pyridine ring suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry. Its carboxylate functional group may participate in various chemical reactions, including esterification and amidation. The tert-butyl group contributes to the compound's hydrophobic character, which can influence its bioavailability and interaction with biological targets. Overall, this compound may be explored for applications in drug development, particularly in the context of targeting specific receptors or enzymes due to its structural features. However, detailed studies on its pharmacological properties and safety profile would be necessary for any practical applications.
Formula:C15H23N3O2
InChI:InChI=1/C15H23N3O2/c1-15(2,3)20-14(19)18-9-6-13(11-18)17-10-12-4-7-16-8-5-12/h4-5,7-8,13,17H,6,9-11H2,1-3H3
InChI key:JPUYCBRZVLMKIS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(C1)NCc1ccncc1
Found 2 products.