CymitQuimica logo

CAS 886365-04-4

:

5-Chloro-4-methyl-2-pyridinecarboxylic acid

Description:
5-Chloro-4-methyl-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) and a chlorine atom at the 5-position, along with a methyl group at the 4-position of the pyridine ring. The presence of these substituents influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic nature of the pyridine ring contributes to its stability and potential for various chemical reactions, such as electrophilic substitution. Additionally, the chlorine atom can enhance the compound's reactivity in nucleophilic substitution reactions. This compound may be of interest in pharmaceutical and agrochemical research due to its potential biological activity and utility in synthesizing other chemical entities. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H6ClNO2
InChI:InChI=1S/C7H6ClNO2/c1-4-2-6(7(10)11)9-3-5(4)8/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=PCWWATZRLUIQNN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C)=C(Cl)C=N1
Synonyms:
  • 5-Chloro-4-methyl-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 5-chloro-4-methyl-
  • 5-Chloro-4-methylpyridine-2-carboxylic acid
Found 4 products.