CymitQuimica logo

CAS 886365-06-6

:

2-Pyridinecarboxylic acid, 5-bromo-4-methyl-, methyl ester

Description:
2-Pyridinecarboxylic acid, 5-bromo-4-methyl-, methyl ester, also known by its CAS number 886365-06-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of a bromine atom at the 5-position and a methyl group at the 4-position of the pyridine ring contributes to its unique chemical properties and reactivity. Typically, such compounds exhibit moderate polarity due to the carboxylate and ester functionalities, which can influence their solubility in various solvents. They may also participate in various chemical reactions, including nucleophilic substitutions and esterification processes. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research and development.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-5-3-7(8(11)12-2)10-4-6(5)9/h3-4H,1-2H3
InChI key:InChIKey=WNUFTWCRMKYPKE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(C)=C(Br)C=N1
Synonyms:
  • Methyl 5-bromo-4-methylpicolinate
  • Methyl 5-bromo-4-methylpyridine-2-carboxylate
  • 2-Pyridinecarboxylic acid, 5-bromo-4-methyl-, methyl ester
Found 4 products.