CymitQuimica logo

CAS 886365-13-5

:

Carbamic acid, [1-[2-amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

Description:
Carbamic acid, [1-[2-amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester, identified by CAS number 886365-13-5, is a chemical compound that belongs to the class of carbamates. This substance features a carbamic acid functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N). The compound contains a pyrrolidine ring, contributing to its cyclic structure, and an amino group, which enhances its potential for hydrogen bonding and reactivity. The presence of the 1,1-dimethylethyl ester moiety indicates that it has a branched alkyl group, which can influence its solubility and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the overall structure, which can be further explored through experimental studies.
Formula:C17H28N4O2
InChI:InChI=1S/C17H28N4O2/c1-17(2,3)23-16(22)20-14-7-8-21(11-14)15(10-18)12-5-4-6-13(19)9-12/h4-6,9,14-15H,7-8,10-11,18-19H2,1-3H3,(H,20,22)
InChI key:InChIKey=BGCOMNOCPUUCFI-UHFFFAOYSA-N
SMILES:C(CN)(N1CC(NC(OC(C)(C)C)=O)CC1)C2=CC(N)=CC=C2
Synonyms:
  • Carbamic acid, [1-[2-amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
Found 2 products.