CymitQuimica logo

CAS 886365-22-6

:

5-Bromo-2-methoxy-4-pyridinecarboxylic acid

Description:
5-Bromo-2-methoxy-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a methoxy group and at the 5-position with a bromine atom. The presence of the carboxylic acid functional group at the 4-position contributes to its acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its bromine substitution can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group can also affect the electronic properties of the molecule, potentially enhancing its reactivity or stability. This compound may find applications in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=JZBHBRMXZANNNF-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(OC)N=CC1Br
Synonyms:
  • 4-Pyridinecarboxylic acid, 5-bromo-2-methoxy-
  • 5-Bromo-2-methoxy-4-pyridinecarboxylic acid
  • 5-Bromo-2-methoxypyridine-4-carboxylic acid
Found 5 products.