CymitQuimica logo

CAS 886365-25-9

:

Methyl 5-bromo-2-methoxy-4-pyridinecarboxylate

Description:
Methyl 5-bromo-2-methoxy-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a bromine substituent at the 5-position and a methoxy group at the 2-position of the pyridine ring, along with a carboxylate ester functional group. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, including medicinal chemistry and agrochemical development. The methoxy group enhances the compound's solubility and can influence its electronic properties, while the carboxylate moiety contributes to its potential as a building block in organic synthesis. Methyl 5-bromo-2-methoxy-4-pyridinecarboxylate is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure allows for diverse chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules.
Formula:C8H8BrNO3
InChI:InChI=1S/C8H8BrNO3/c1-12-7-3-5(8(11)13-2)6(9)4-10-7/h3-4H,1-2H3
InChI key:InChIKey=HSPQMLCPRUPXSD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(OC)N=CC1Br
Synonyms:
  • Methyl 5-bromo-2-methoxy-4-pyridinecarboxylate
  • 4-Pyridinecarboxylic acid, 5-bromo-2-methoxy-, methyl ester
  • 5-Bromo-2-methoxypyridine-4-carboxylic acid methyl ester
Found 5 products.