CymitQuimica logo

CAS 886365-43-1

:

5-Bromo-3-methylpyridine-2-carboxylic acid

Description:
5-Bromo-3-methylpyridine-2-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom, a methyl group, and a carboxylic acid functional group. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical syntheses and applications. The methyl group contributes to the compound's hydrophobic characteristics, while the carboxylic acid group imparts acidic properties, allowing for potential interactions in biological systems or as a reagent in organic synthesis. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure allows for various functionalization reactions, making it a versatile intermediate in organic chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and conditions, which is important for its practical applications. Overall, 5-Bromo-3-methylpyridine-2-carboxylic acid is a valuable compound in the field of medicinal chemistry and materials science.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-4-2-5(8)3-9-6(4)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:GSOCTKHBFREQCV-UHFFFAOYSA-N
SMILES:Cc1cc(cnc1C(=O)O)Br
Synonyms:
  • 5-Bromo-2-carboxy-3-methylpyridine
  • 2-Pyridinecarboxylic Acid, 5-Bromo-3-Methyl-
  • 5-Bromo-3-methylpicolinic acid
Found 5 products.