CymitQuimica logo

CAS 886366-61-6

:

methyl 2-[(tert-butoxycarbonylamino)methyl]-3-(m-tolyl)propanoate

Description:
Methyl 2-[(tert-butoxycarbonylamino)methyl]-3-(m-tolyl)propanoate is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a tert-butoxycarbonyl (Boc) protecting group, and an aromatic m-tolyl group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the Boc group indicates that this compound is likely used in peptide synthesis or as an intermediate in organic synthesis, providing protection for the amine during reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents, making it a valuable candidate for further chemical modifications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H25NO4
InChI:InChI=1/C17H25NO4/c1-12-7-6-8-13(9-12)10-14(15(19)21-5)11-18-16(20)22-17(2,3)4/h6-9,14H,10-11H2,1-5H3,(H,18,20)
InChI key:NZEJTRBFELLKIU-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)CC(CNC(=O)OC(C)(C)C)C(=O)OC
Found 1 products.