CymitQuimica logo

CAS 886367-24-4

:

5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro-7,9-dimethyl-

Description:
5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro-7,9-dimethyl- is a chemical compound characterized by its bicyclic structure, which includes a benzene ring fused to a seven-membered azepine ring. This compound features a ketone functional group at the 5-position and two methyl groups at the 7 and 9 positions of the azepine ring, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen in the ring structure. The tetrahydro configuration indicates that the compound is saturated, which affects its reactivity and stability. Such compounds often exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific arrangement of substituents can influence the compound's pharmacological properties, including its potential interactions with biological targets. Overall, 5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro-7,9-dimethyl- represents a class of compounds that may have applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H15NO
InChI:InChI=1S/C12H15NO/c1-8-6-9(2)12-10(7-8)11(14)4-3-5-13-12/h6-7,13H,3-5H2,1-2H3
InChI key:NHRMNGWYLGVOOQ-UHFFFAOYSA-N
SMILES:CC1=CC(=C2C(=C1)C(=O)CCCN2)C
Synonyms:
  • 7,9-Dimethyl-1,2,3,4-Tetrahydro-Benzo[B]Azepin-5-One
  • 7,9-dimethyl-3,4-dihydro-1H-benzo[b]azepin-5(2H)-one
  • 7,9-Dimethyl-1,2,3,4-Tetrahydro-1-Benzazepin-5-One
Found 1 products.