CymitQuimica logo

CAS 88639-91-2

:

2-Naphthalenecarboxylic acid, 2-methylphenyl ester

Description:
2-Naphthalenecarboxylic acid, 2-methylphenyl ester, also known as 2-methylphenyl 2-naphthoate, is an organic compound characterized by its ester functional group derived from 2-naphthalenecarboxylic acid and 2-methylphenol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic naphthalene structure. The compound exhibits moderate stability under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its chemical properties include the potential for aromatic substitution reactions, making it useful in various organic synthesis applications. Additionally, it may possess biological activity, which can be explored in pharmaceutical or agrochemical contexts. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C18H14O2
InChI:InChI=1S/C18H14O2/c1-13-6-2-5-9-17(13)20-18(19)16-11-10-14-7-3-4-8-15(14)12-16/h2-12H,1H3
InChI key:UEMAZHYHANXBBG-UHFFFAOYSA-N
SMILES:CC1=CC=CC=C1OC(=O)C2=CC3=CC=CC=C3C=C2
Found 1 products.