CymitQuimica logo

CAS 88641-75-2

:

Benzene, 1,1',1''-(1,1,5,5-tetramethyl-2-pentene-1,3,5-triyl)tris-

Description:
Benzene, 1,1',1''-(1,1,5,5-tetramethyl-2-pentene-1,3,5-triyl)tris- is a complex organic compound characterized by its structure, which includes a benzene ring and a trisubstituted alkene moiety. The presence of the tetramethyl groups indicates a high degree of branching, which can influence the compound's physical properties, such as boiling point and solubility. This compound is likely to exhibit hydrophobic characteristics due to the benzene ring and the bulky alkyl substituents, making it less soluble in polar solvents. Additionally, the presence of multiple double bonds in the alkene structure may impart reactivity, particularly in addition reactions. The compound's molecular structure suggests potential applications in materials science or as an intermediate in organic synthesis. However, specific safety and handling information should be consulted, as compounds with complex structures can exhibit varied toxicological profiles. Overall, this compound exemplifies the diversity of organic chemistry and the intricate relationships between molecular structure and chemical behavior.
Formula:C27H30
InChI:InChI=1S/C27H30/c1-26(2,24-16-10-6-11-17-24)20-23(22-14-8-5-9-15-22)21-27(3,4)25-18-12-7-13-19-25/h5-20H,21H2,1-4H3
InChI key:BFMWKVOCVQQZMA-UHFFFAOYSA-N
SMILES:CC(C)(CC(=CC(C)(C)C1=CC=CC=C1)C2=CC=CC=C2)C3=CC=CC=C3
Found 1 products.