CymitQuimica logo

CAS 88648-72-0

:

Phosphinic acid, (2-chloro-1-hydroxyethyl)-

Description:
Phosphinic acid, (2-chloro-1-hydroxyethyl)-, with the CAS number 88648-72-0, is an organophosphorus compound characterized by the presence of a phosphinic acid functional group. This substance typically features a phosphorus atom bonded to a hydroxyethyl group and a chlorine atom, which contributes to its reactivity and potential applications. The presence of the hydroxyethyl moiety suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. The chlorine atom can influence the compound's biological activity and stability, making it of interest in various fields, including agrochemicals and pharmaceuticals. Phosphinic acids are known for their role as intermediates in organic synthesis and may also exhibit antimicrobial properties. Safety and handling considerations are essential due to the potential toxicity associated with organophosphorus compounds. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and application in chemical synthesis and industry.
Formula:C2H6ClO3P
InChI:InChI=1S/C2H4ClO3P/c3-1-2(4)7(5)6/h2,4H,1H2/p+1
InChI key:ZQUSIRQWBOLXCJ-UHFFFAOYSA-O
SMILES:C(C(O)[P+](=O)O)Cl
Found 1 products.