CAS 88649-74-5
:1-Pentene, 1,1-dichloro-2-(pentylthio)-
Description:
1-Pentene, 1,1-dichloro-2-(pentylthio)- is an organic compound characterized by its unique structure, which includes a pentene backbone with dichloro and pentylthio substituents. This compound features a double bond between the first and second carbon atoms of the pentene chain, contributing to its reactivity and potential applications in organic synthesis. The presence of two chlorine atoms introduces significant polarity and can influence the compound's solubility and interaction with other substances. The pentylthio group enhances the compound's hydrophobic characteristics, making it more soluble in organic solvents. This compound may exhibit properties typical of alkenes, such as undergoing addition reactions, and its chlorinated nature could impart specific biological or chemical activities. As with many organochlorine compounds, it is essential to consider environmental and health implications, as chlorinated compounds can be persistent in the environment and may pose toxicity risks. Overall, 1-Pentene, 1,1-dichloro-2-(pentylthio)- is a complex molecule with diverse potential applications in chemical synthesis and materials science.
Formula:C10H18Cl2S
InChI:InChI=1S/C10H18Cl2S/c1-3-5-6-8-13-9(7-4-2)10(11)12/h3-8H2,1-2H3
InChI key:VJHZZPXSNZIDRJ-UHFFFAOYSA-N
SMILES:CCCCCSC(=C(Cl)Cl)CCC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
