CymitQuimica logo

CAS 886496-79-3

:

4-chloro-2-(trifluoromethyl)benzamide

Description:
4-Chloro-2-(trifluoromethyl)benzamide is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a chloro group and a trifluoromethyl group, along with an amide functional group. The presence of the chloro substituent enhances the compound's reactivity and can influence its biological activity, while the trifluoromethyl group is known for imparting unique electronic properties and increasing lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, particularly due to the presence of the trifluoromethyl group, which is often associated with enhanced metabolic stability and bioactivity. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by the specific arrangement of substituents on the benzene ring. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C8H5ClF3NO
InChI:InChI=1/C8H5ClF3NO/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H2,13,14)
InChI key:MRURROGSGQQKOB-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)C(F)(F)F)C(=N)O
Synonyms:
  • Benzamide, 4-Chloro-2-(Trifluoromethyl)-
  • Zvr Dg Bxfff
  • 4-Chloro-2-(trifluoromethyl)benzamide
Found 4 products.