CymitQuimica logo

CAS 886497-22-9

:

3-Chloro-5-fluoro-4-methoxybenzoic acid

Description:
3-Chloro-5-fluoro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a chlorine atom, a fluorine atom, and a methoxy group. The chlorine atom is located at the 3-position, the fluorine at the 5-position, and the methoxy group at the 4-position of the benzene ring. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The presence of halogen substituents can influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Additionally, the methoxy group can enhance the compound's lipophilicity, affecting its absorption and distribution in biological systems. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C8H6ClFO3
InChI:InChI=1S/C8H6ClFO3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12)
InChI key:FDWCHZNFULHBCP-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1Cl)C(=O)O)F
Found 3 products.