CymitQuimica logo

CAS 886497-81-0

:

2-Fluoro-5-(trifluoromethoxy)benzaldehyde

Description:
2-Fluoro-5-(trifluoromethoxy)benzaldehyde is an aromatic compound characterized by the presence of a fluorine atom and a trifluoromethoxy group attached to a benzaldehyde moiety. The molecular structure features a benzene ring with a formyl group (-CHO) at one position and a trifluoromethoxy group (-O-CF3) at another, specifically in the 5-position relative to the aldehyde. This compound is notable for its high electronegativity due to the presence of multiple fluorine atoms, which can significantly influence its reactivity and interaction with other chemical species. The trifluoromethoxy group enhances the compound's lipophilicity and can affect its solubility in various solvents. Additionally, the presence of the aldehyde functional group makes it a potential candidate for further chemical transformations, such as nucleophilic additions or condensation reactions. Overall, 2-Fluoro-5-(trifluoromethoxy)benzaldehyde is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its unique electronic properties.
Formula:C8H4F4O2
InChI:InChI=1S/C8H4F4O2/c9-7-2-1-6(3-5(7)4-13)14-8(10,11)12/h1-4H
InChI key:InChIKey=FMDGCHMPSCBYFX-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(C=O)=C(F)C=C1
Synonyms:
  • Benzaldehyde, 2-fluoro-5-(trifluoromethoxy)-
  • 2-Fluoro-5-(trifluoromethoxy)benzaldehyde
  • 2-Fluoro-5-trifluoromethoxybenzaldehyde
  • 2-Fluoro-5-(trifluoromethoxy)benzaldehyde98%
  • 2-Formyl-4-(trifluoromethoxy)fluorobenzene
  • 2-Fluoro-5-(trifluoromethoxy)benzaldehyde97%
Found 4 products.