CymitQuimica logo

CAS 886498-60-8

:

2,6-Difluoro-3-methoxyphenol

Description:
2,6-Difluoro-3-methoxyphenol is an organic compound characterized by its phenolic structure, which includes a methoxy group (-OCH3) and two fluorine atoms positioned at the 2 and 6 positions of the aromatic ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the fluorine substituents. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a phenolic compound, it exhibits properties typical of phenols, such as acidity and the ability to form hydrogen bonds. Additionally, the fluorine atoms can enhance the compound's stability and lipophilicity, making it an interesting candidate for various chemical syntheses and applications. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H6F2O2
InChI:InChI=1/C7H6F2O2/c1-11-5-3-2-4(8)7(10)6(5)9/h2-3,10H,1H3
InChI key:UOVAWRHEABQHGR-UHFFFAOYSA-N
SMILES:COc1ccc(c(c1F)O)F
Synonyms:
  • Phenol, 2,6-Difluoro-3-Methoxy-
  • Qr Bf Ff Co1
Found 4 products.