CymitQuimica logo

CAS 886500-59-0

:

2-Methoxy-4-(trifluoromethyl)benzyl bromide

Description:
2-Methoxy-4-(trifluoromethyl)benzyl bromide is an organic compound characterized by its aromatic structure, which includes a methoxy group and a trifluoromethyl group attached to a benzyl bromide moiety. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity in nucleophilic substitution reactions. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly affect the compound's chemical behavior, making it more electrophilic. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical transformations. Additionally, the bromide functional group serves as a good leaving group, facilitating substitution reactions. The compound's physical properties, such as boiling point and melting point, are influenced by its molecular structure and the presence of the halogen and functional groups. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C9H8BrF3O
InChI:InChI=1S/C9H8BrF3O/c1-14-8-4-7(9(11,12)13)3-2-6(8)5-10/h2-4H,5H2,1H3
InChI key:WWAGWLZAZFSJRH-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)C(F)(F)F)CBr
Found 4 products.