CymitQuimica logo

CAS 886500-89-6

:

(4-Chloro-3-(trifluoromethoxy)phenyl)methanol

Description:
(4-Chloro-3-(trifluoromethoxy)phenyl)methanol is an organic compound characterized by its phenolic structure, which features a chlorine atom and a trifluoromethoxy group attached to a benzene ring. The presence of the chloro substituent typically enhances the compound's reactivity and can influence its biological activity, while the trifluoromethoxy group contributes to its lipophilicity and potential for interaction with various biological targets. This compound is likely to exhibit moderate to high polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. Additionally, the trifluoromethoxy group may impart unique electronic properties, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C8H6ClF3O2
InChI:InChI=1S/C8H6ClF3O2/c9-6-2-1-5(4-13)3-7(6)14-8(10,11)12/h1-3,13H,4H2
InChI key:AQFVCOVRKUVQTA-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1CO)OC(F)(F)F)Cl
Synonyms:
  • [4-chloro-3-(trifluoromethoxy)phenyl]methanol
Found 3 products.