CymitQuimica logo

CAS 886503-11-3

:

Pyrrolidine, 2-(3,5-difluorophenyl)-

Description:
Pyrrolidine, 2-(3,5-difluorophenyl)-, is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a 3,5-difluorophenyl group at the second position of the pyrrolidine ring introduces significant steric and electronic effects, influencing the compound's reactivity and potential applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic fluorinated substituent. The difluorophenyl group enhances the compound's lipophilicity, which may affect its biological activity and interactions with other molecules. Pyrrolidine derivatives are often studied for their potential pharmacological properties, including roles in medicinal chemistry as intermediates or active pharmaceutical ingredients. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H11F2N
InChI:InChI=1S/C10H11F2N/c11-8-4-7(5-9(12)6-8)10-2-1-3-13-10/h4-6,10,13H,1-3H2
InChI key:INAOTHVFVJELEL-UHFFFAOYSA-N
SMILES:C1CC(NC1)C2=CC(=CC(=C2)F)F
Found 4 products.