CymitQuimica logo

CAS 886503-33-9

:

1-(Bromomethyl)-3-chloro-5-(trifluoromethoxy)benzene

Description:
1-(Bromomethyl)-3-chloro-5-(trifluoromethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromomethyl group, a chlorine atom, and a trifluoromethoxy group. The presence of the bromomethyl group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The chlorine atom adds to its reactivity, while the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or materials science due to its unique electronic and steric properties. Its trifluoromethoxy group can also impart specific characteristics such as increased stability and altered solubility in various solvents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound exemplifies the complexity and utility of halogenated aromatic compounds in chemical research and industry.
Formula:C8H5BrClF3O
InChI:InChI=1S/C8H5BrClF3O/c9-4-5-1-6(10)3-7(2-5)14-8(11,12)13/h1-3H,4H2
InChI key:InChIKey=HMVSKKRMOPJKLU-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(CBr)=CC(Cl)=C1
Synonyms:
  • Benzene, 1-(bromomethyl)-3-chloro-5-(trifluoromethoxy)-
  • 1-(Bromomethyl)-3-chloro-5-(trifluoromethoxy)benzene
Found 3 products.