CymitQuimica logo

CAS 886510-25-4

:

4-bromo-5-fluoro-2-methoxy-phenol

Description:
4-Bromo-5-fluoro-2-methoxy-phenol is an organic compound characterized by its aromatic structure, which includes a phenolic group. This compound features a bromine atom and a fluorine atom substituted at the 4 and 5 positions, respectively, on the benzene ring, along with a methoxy group (-OCH3) at the 2 position. The presence of these substituents contributes to its unique chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The bromine and fluorine atoms can influence the compound's electronic properties, making it a candidate for further chemical modifications or reactions. Additionally, the methoxy group can enhance solubility in organic solvents and may affect the compound's biological activity. As a phenolic compound, it may exhibit antioxidant properties and could be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C7H6BrFO2
InChI:InChI=1/C7H6BrFO2/c1-11-7-2-4(8)5(9)3-6(7)10/h2-3,10H,1H3
InChI key:BJNIUDHOXUKBCY-UHFFFAOYSA-N
SMILES:COc1cc(c(cc1O)F)Br
Synonyms:
  • 4-Bromo-5-fluoro-2-methoxyphenol
  • Phenol, 4-bromo-5-fluoro-2-methoxy-
Found 4 products.