CymitQuimica logo

CAS 88654-17-5

:

1-Methyl-4-piperidinecarbothioamide

Description:
1-Methyl-4-piperidinecarbothioamide is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of a methyl group at the 1-position and a carbothioamide functional group at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the nitrogen and sulfur atoms, which can engage in hydrogen bonding. It may also display basic properties due to the nitrogen atom in the piperidine ring. The carbothioamide group introduces reactivity, particularly in nucleophilic substitution reactions, and can participate in various chemical transformations. Additionally, 1-Methyl-4-piperidinecarbothioamide may have applications in medicinal chemistry, potentially serving as a scaffold for drug development or as a reagent in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14N2S
InChI:InChI=1S/C7H14N2S/c1-9-4-2-6(3-5-9)7(8)10/h6H,2-5H2,1H3,(H2,8,10)
InChI key:InChIKey=MHYXWOIIIZRCAJ-UHFFFAOYSA-N
SMILES:C(N)(=S)C1CCN(C)CC1
Synonyms:
  • 1-Methylpiperidine-4-carbothioamide
  • 1-Methyl-4-piperidinecarbothioamide
  • 4-Piperidinecarbothioamide, 1-methyl-
Found 2 products.