CAS 88661-27-2
:Phenol, 4-ethyl-2-mercapto-
Description:
Phenol, 4-ethyl-2-mercapto- is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and a thiol group (-SH) attached to a benzene ring, along with an ethyl substituent. This compound is part of the thiophenol family, where the mercapto group contributes to its reactivity and potential applications in various chemical processes. It typically exhibits moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the ethyl group and the aromatic ring. The presence of the thiol group imparts distinct properties, such as the ability to form disulfide bonds and participate in redox reactions. Additionally, the compound may exhibit antioxidant properties and can be used in the synthesis of other organic compounds. Safety considerations are important, as thiols can have strong odors and may be toxic or irritating. Overall, 4-ethyl-2-mercapto-phenol is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science.
Formula:C8H10OS
InChI:InChI=1S/C8H10OS/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3
InChI key:UIKWHZMPLNYNHF-UHFFFAOYSA-N
SMILES:CCC1=CC(=C(C=C1)O)S
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
