CymitQuimica logo

CAS 88673-61-4

:

4-Piperidinone, 1-methyl-3-(phenylmethyl)-

Description:
4-Piperidinone, 1-methyl-3-(phenylmethyl)-, with the CAS number 88673-61-4, is a chemical compound that belongs to the class of piperidinones, which are cyclic amines featuring a piperidine ring with a ketone functional group. This compound typically exhibits a molecular structure characterized by a piperidinone core substituted with a methyl group at the nitrogen atom and a phenylmethyl group at the 3-position. It is generally a white to off-white solid, soluble in organic solvents, and may have moderate stability under standard conditions. The presence of both the piperidinone and phenylmethyl groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the compound may exhibit various biological activities, although specific pharmacological properties would require further investigation. As with many organic compounds, handling should be done with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c1-14-8-7-13(15)12(10-14)9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3
InChI key:JNQDCVKRNDEHPD-UHFFFAOYSA-N
SMILES:CN1CCC(=O)C(C1)CC2=CC=CC=C2
Found 1 products.