CymitQuimica logo

CAS 88674-82-2

:

(5E)-5-[(5-methylfuran-2-yl)methylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one

Description:
The chemical substance known as (5E)-5-[(5-methylfuran-2-yl)methylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one, with the CAS number 88674-82-2, is characterized by its unique structural features that include a thiazole ring, a sulfur atom, and a furan moiety. This compound exhibits a thiazolone framework, which is known for its potential biological activity, including antimicrobial and antifungal properties. The presence of the 5-methylfuran group suggests that it may also possess interesting electronic and steric properties, potentially influencing its reactivity and interactions with biological targets. The compound's thiazole and furan components contribute to its aromatic character, which can enhance stability and solubility in organic solvents. Additionally, the specific configuration indicated by the "(5E)" notation suggests a particular geometric arrangement around the double bond, which may play a crucial role in its biological activity and chemical reactivity. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.
Formula:C9H7NO2S2
InChI:InChI=1/C9H7NO2S2/c1-5-2-3-6(12-5)4-7-8(11)10-9(13)14-7/h2-4H,1H3,(H,10,11,13)/b7-4+
InChI key:UIWYMDIBJKBBKW-QPJJXVBHSA-N
SMILES:CC1=CC=C(O1)/C=C/2\C(=O)NC(=S)S2
Synonyms:
  • 4(5H)-thiazolone, 2-mercapto-5-[(5-methyl-2-furanyl)methylene]-, (5E)-
Found 4 products.