CAS 88675-44-9
:Ethanone, 1-(4-bromophenyl)-2-phenyl-2-(1-piperidinyl)-
Description:
Ethanone, 1-(4-bromophenyl)-2-phenyl-2-(1-piperidinyl)-, also known by its CAS number 88675-44-9, is a synthetic organic compound that belongs to the class of ketones. This compound features a ketone functional group, characterized by the presence of a carbonyl group (C=O) bonded to two carbon atoms. The structure includes a piperidine ring, which contributes to its potential biological activity, and two phenyl groups that enhance its aromatic character. The presence of a bromine atom on one of the phenyl rings may influence its reactivity and solubility properties. This compound is of interest in medicinal chemistry and pharmacology due to its potential applications in drug development. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. As with many organic compounds, safety data and handling precautions are essential for its use in laboratory settings.
Formula:C19H20BrNO
InChI:InChI=1S/C19H20BrNO/c20-17-11-9-16(10-12-17)19(22)18(15-7-3-1-4-8-15)21-13-5-2-6-14-21/h1,3-4,7-12,18H,2,5-6,13-14H2
InChI key:MTJHAZRXUIFVDW-UHFFFAOYSA-N
SMILES:C1CCN(CC1)C(C2=CC=CC=C2)C(=O)C3=CC=C(C=C3)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanone, 1-(4-bromophenyl)-2-phenyl-2-(1-piperidinyl)-
CAS:Formula:C19H20BrNOMolecular weight:358.2722
