CymitQuimica logo

CAS 886762-63-6

:

1,3-Difluoro-2-iodo-5-nitrobenzene

Description:
1,3-Difluoro-2-iodo-5-nitrobenzene is an aromatic compound characterized by the presence of two fluorine atoms, one iodine atom, and one nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 5-position, which is known for its electron-withdrawing properties, influencing the compound's reactivity and stability. The presence of fluorine atoms at the 1 and 3 positions enhances the compound's electronegativity and can affect its solubility and interaction with other chemical species. The iodine atom at the 2-position introduces a heavier halogen, which can participate in various substitution reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of functional groups allows for diverse reactivity, making it a valuable compound in chemical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C6H2F2INO2
InChI:InChI=1S/C6H2F2INO2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H
InChI key:InChIKey=HNFGWHASOYPJPT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(F)=C(I)C(F)=C1
Synonyms:
  • 1,3-Difluoro-2-iodo-5-nitrobenzene
  • Benzene, 1,3-difluoro-2-iodo-5-nitro-
Found 1 products.