CymitQuimica logo

CAS 886771-02-4

:

3-Pyridin-3-Yl-Piperazine-1-Carboxylic Acid Tert-Butyl Ester

Description:
3-Pyridin-3-Yl-Piperazine-1-Carboxylic Acid Tert-Butyl Ester is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyridine moiety. This compound typically exhibits properties associated with both piperazine and pyridine derivatives, such as potential basicity due to the nitrogen atoms in the rings. The tert-butyl ester group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of the carboxylic acid functionality suggests that it can participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit specific biological activities, making it of interest in drug discovery and development. As with many organic compounds, its stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature.
Formula:C14H21N3O2
InChI:InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-8-7-16-12(10-17)11-5-4-6-15-9-11/h4-6,9,12,16H,7-8,10H2,1-3H3
InChI key:YTZNVXDPMKDFHB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCNC(C1)C2=CN=CC=C2
Synonyms:
  • Tert-Butyl 3-Pyridin-3-Ylpiperazine-1-Carboxylate
  • 3Bpy-P03-01
  • N-Boc-3-pyridin-3-yl-piperazine
  • Ar1454
  • 3-pyridin-3-yl-piperazine-1-carboxylic acid tert-butyl ester
Found 3 products.