CAS 88681-16-7
:2-Propen-1-one, 3-(4-bromophenyl)-1-(4-phenoxyphenyl)-
Description:
2-Propen-1-one, 3-(4-bromophenyl)-1-(4-phenoxyphenyl)-, also known by its CAS number 88681-16-7, is an organic compound characterized by its structure, which includes a propenone moiety with substituents that enhance its reactivity and potential applications. This compound features a bromophenyl group and a phenoxyphenyl group, contributing to its unique electronic properties and potential for use in various chemical reactions, such as polymerization or as a building block in organic synthesis. It is likely to exhibit properties typical of unsaturated carbonyl compounds, including reactivity towards nucleophiles and electrophiles. The presence of bromine may impart additional characteristics, such as increased lipophilicity and the potential for further functionalization. As with many organic compounds, its physical properties, such as solubility, boiling point, and melting point, would depend on the specific molecular interactions and the environment in which it is studied. Safety data should be consulted to understand its handling and potential hazards.
Formula:C21H15BrO2
InChI:InChI=1S/C21H15BrO2/c22-18-11-6-16(7-12-18)8-15-21(23)17-9-13-20(14-10-17)24-19-4-2-1-3-5-19/h1-15H
InChI key:COIZJVURERMPLY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C=CC3=CC=C(C=C3)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Propen-1-one, 3-(4-bromophenyl)-1-(4-phenoxyphenyl)-
CAS:Formula:C21H15BrO2Molecular weight:379.2466
