CymitQuimica logo

CAS 886851-49-6

:

N-Methyl-3-(2-pyrimidinyl)benzenemethanamine

Description:
N-Methyl-3-(2-pyrimidinyl)benzenemethanamine, identified by its CAS number 886851-49-6, is a chemical compound that features a benzene ring substituted with a pyrimidine moiety and a methylamino group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role as a pharmacophore in drug development. The presence of the pyrimidine ring contributes to its ability to interact with biological targets, such as enzymes or receptors, which may be relevant in therapeutic contexts. The methyl group attached to the nitrogen atom enhances its lipophilicity, potentially influencing its pharmacokinetic properties, such as absorption and distribution within biological systems. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent system used, which is crucial for its application in various chemical and biological assays. Overall, N-Methyl-3-(2-pyrimidinyl)benzenemethanamine represents a class of compounds that can be significant in the exploration of new therapeutic agents.
Formula:C12H13N3
InChI:InChI=1/C12H13N3/c1-13-9-10-4-2-5-11(8-10)12-14-6-3-7-15-12/h2-8,13H,9H2,1H3
InChI key:InChIKey=AHOVMAYXXRVWIS-UHFFFAOYSA-N
SMILES:C(NC)C=1C=C(C=CC1)C=2N=CC=CN2
Synonyms:
  • N-Methyl-3-(2-pyrimidinyl)benzenemethanamine
  • Benzenemethanamine, N-methyl-3-(2-pyrimidinyl)-
Found 2 products.