CymitQuimica logo

CAS 886851-51-0

:

[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]methanol

Description:
[2-Morpholin-4-yl-5-(trifluoromethyl)phenyl]methanol, with the CAS number 886851-51-0, is a chemical compound characterized by its unique structure that includes a morpholine ring and a trifluoromethyl group attached to a phenyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The morpholine ring adds to the compound's potential as a pharmacophore, often enhancing its interaction with biological targets. Additionally, the compound may exhibit specific reactivity patterns typical of alcohols and can participate in various chemical reactions, including oxidation and esterification. Its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its toxicity, stability, and specific applications would be necessary for comprehensive understanding.
Formula:C12H14F3NO2
InChI:InChI=1/C12H14F3NO2/c13-12(14,15)10-1-2-11(9(7-10)8-17)16-3-5-18-6-4-16/h1-2,7,17H,3-6,8H2
InChI key:KYVJYGRFMSNHDV-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(F)(F)F)CO)N1CCOCC1
Synonyms:
  • [2-Morpholino-5-(Trifluoromethyl)Phenyl]Methanol
Found 2 products.