CAS 88690-84-0
:2H-1,3-Oxazine, 3-(benzoyloxy)-2-[4-(dimethylamino)phenyl]tetrahydro-
Description:
2H-1,3-Oxazine, 3-(benzoyloxy)-2-[4-(dimethylamino)phenyl]tetrahydro- is a chemical compound characterized by its oxazine ring structure, which is a six-membered heterocyclic compound containing one oxygen and one nitrogen atom. This compound features a benzoyloxy group, indicating the presence of a benzoyl moiety attached via an oxygen atom, which can influence its reactivity and solubility. Additionally, the presence of a dimethylamino group suggests potential basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions. The tetrahydro configuration indicates that the compound has a saturated structure, which may contribute to its stability and physical properties. Overall, this compound is likely to exhibit interesting chemical behavior due to its unique functional groups, making it potentially useful in various applications, including pharmaceuticals, dyes, or as an intermediate in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C19H22N2O3
InChI:InChI=1S/C19H22N2O3/c1-20(2)17-11-9-15(10-12-17)18-21(13-6-14-23-18)24-19(22)16-7-4-3-5-8-16/h3-5,7-12,18H,6,13-14H2,1-2H3
InChI key:NLJGDOARUAKQOK-UHFFFAOYSA-N
SMILES:CN(C)C1=CC=C(C=C1)C2N(CCCO2)OC(=O)C3=CC=CC=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2H-1,3-Oxazine, 3-(benzoyloxy)-2-[4-(dimethylamino)phenyl]tetrahydro-
CAS:Formula:C19H22N2O3Molecular weight:326.3896
