CymitQuimica logo

CAS 88691-91-2

:

Nonanedinitrile, 2,8-dimethyl-

Description:
Nonanedinitrile, 2,8-dimethyl- is an organic compound characterized by its structure, which includes a nonane backbone with two cyano (nitrile) functional groups located at the terminal ends, along with two methyl groups positioned at the 2nd and 8th carbon atoms of the chain. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively high boiling point and low solubility in water, which is common for nitriles due to their hydrophobic hydrocarbon chains. Nonanedinitrile, 2,8-dimethyl- may exhibit moderate toxicity and should be handled with care in a laboratory setting. Its applications can include use as an intermediate in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. As with many nitriles, it may also participate in reactions such as hydrolysis, leading to the formation of corresponding carboxylic acids. Proper safety measures should be observed when working with this compound to mitigate any potential health risks.
Formula:C11H18N2
InChI:InChI=1S/C11H18N2/c1-10(8-12)6-4-3-5-7-11(2)9-13/h10-11H,3-7H2,1-2H3
InChI key:PITUYKHMRZYCFH-UHFFFAOYSA-N
SMILES:CC(CCCCCC(C)C#N)C#N
Found 1 products.