CAS 88695-91-4
:Carbamic fluoride, methyl[[methyl(2-methyl-1-oxopropyl)amino]thio]-
Description:
Carbamic fluoride, methyl[[methyl(2-methyl-1-oxopropyl)amino]thio]- is a chemical compound characterized by its unique structure, which includes a carbamic acid derivative with a fluoride substituent. This compound features a methyl group and a thioether linkage, indicating the presence of sulfur in its molecular framework. The presence of the amino group suggests potential reactivity, particularly in nucleophilic substitution reactions. The compound's molecular structure may impart specific properties such as solubility in organic solvents and potential biological activity, which could be of interest in pharmaceutical applications. Additionally, the presence of the oxopropyl group indicates that it may participate in various chemical reactions, including those involving carbonyl functionalities. As with many fluorinated compounds, it may exhibit unique stability and reactivity patterns compared to its non-fluorinated counterparts. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds and the reactive nature of the functional groups present.
Formula:C7H13FN2O2S
InChI:InChI=1S/C7H13FN2O2S/c1-5(2)6(11)9(3)13-10(4)7(8)12/h5H,1-4H3
InChI key:YLOWLENINNPMSU-UHFFFAOYSA-N
SMILES:CC(C)C(=O)N(C)SN(C)C(=O)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Carbamic fluoride, methyl[[methyl(2-methyl-1-oxopropyl)amino]thio]-
CAS:Formula:C7H13FN2O2SMolecular weight:208.2537
