CAS 886968-24-7
:Ethanol, 2,2'-[(5-methoxy-1,3-phenylene)diimino]bis-
Description:
Ethanol, 2,2'-[(5-methoxy-1,3-phenylene)diimino]bis- is a chemical compound characterized by its complex structure, which includes an ethanol backbone and a bis-imino group derived from a methoxy-substituted phenylene. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other molecules. This compound likely exhibits properties typical of imines, such as potential reactivity towards nucleophiles and the ability to participate in condensation reactions. The phenylene moiety contributes to its aromatic characteristics, which can affect its stability and electronic properties. Additionally, the compound may display interesting optical properties due to its conjugated system. Its applications could span various fields, including materials science and organic synthesis, although specific uses would depend on further research into its reactivity and stability under different conditions. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C11H18N2O3
InChI:InChI=1S/C11H18N2O3/c1-16-11-7-9(12-2-4-14)6-10(8-11)13-3-5-15/h6-8,12-15H,2-5H2,1H3
InChI key:IIWYRAMJUYVHGG-UHFFFAOYSA-N
SMILES:COC1=CC(=CC(=C1)NCCO)NCCO
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
