CymitQuimica logo

CAS 88701-65-9

:

1-Piperazinecarboxylicacid, 4-methyl-, hydrazide

Description:
1-Piperazinecarboxylic acid, 4-methyl-, hydrazide, identified by CAS number 88701-65-9, is a chemical compound characterized by its piperazine and hydrazide functional groups. This compound typically exhibits properties associated with both amines and carboxylic acids, which can influence its solubility and reactivity. It is likely to be a white to off-white solid, soluble in polar solvents such as water and alcohols, due to the presence of the hydrazide moiety. The piperazine ring contributes to its basicity and potential for forming hydrogen bonds, enhancing its interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly for its potential biological activities, including antimicrobial or anticancer properties. Additionally, its structure allows for various modifications, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H14N4O
InChI:InChI=1S/C6H14N4O/c1-9-2-4-10(5-3-9)6(11)8-7/h2-5,7H2,1H3,(H,8,11)
InChI key:TUXFLPICTVEGND-UHFFFAOYSA-N
SMILES:CN1CCN(CC1)C(=O)NN
Synonyms:
  • 1-Piperazinecarboxylicacid,4-methyl-,hydrazide(7CI,9CI)
  • 4-Methylpiperazine-1-Carbohydrazide
Found 2 products.